C22H26ClN3O4S — CID 24639183
N-[1-(4-tert-butylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide (PubChem CID 24639183) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is N-[1-(4-tert-butylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[1-(4-tert-butylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 24639183 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-[1-(4-tert-butylanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
| SMILES | CSCCC(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H26ClN3O4S/c1-22(2,3)15-6-8-16(9-7-15)24-21(28)18(11-12-31-4)25-20(27)14-5-10-17(23)19(13-14)26(29)30/h5-10,13,18H,11-12H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | PPVXJLHHAFXOJZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|