C22H26ClN3O6S — CID 24645400
4-chloro-N-[1-[2-(4-ethoxyphenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 24645400) has the molecular formula C22H26ClN3O6S and a molecular weight of 495.99 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-(4-ethoxyphenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[1-[2-(4-ethoxyphenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24645400 |
| Molecular Formula | C22H26ClN3O6S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 4-chloro-N-[1-[2-(4-ethoxyphenoxy)ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(OCCNC(=O)C(CCSC)NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H26ClN3O6S/c1-3-31-16-5-7-17(8-6-16)32-12-11-24-22(28)19(10-13-33-2)25-21(27)15-4-9-18(23)20(14-15)26(29)30/h4-9,14,19H,3,10-13H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | DWEKKQMWINUPRX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|