C23H33N3O3S — CID 24640211
4-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzamide (PubChem CID 24640211) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 4-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzamide.
| Compound Name | 4-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24640211 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]benzamide |
| SMILES | CCc1ccc(C(CNC(=O)c2ccc(S(=O)(=O)NC(C)(C)C)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C23H33N3O3S/c1-7-17-8-10-18(11-9-17)21(26(5)6)16-24-22(27)19-12-14-20(15-13-19)30(28,29)25-23(2,3)4/h8-15,21,25H,7,16H2,1-6H3,(H,24,27) |
| InChIKey | LYGWFILPFNJGKX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |