C18H18BrN3O6S — CID 24640863
N-[3-[2-(4-bromobenzoyl)hydrazinyl]-3-oxopropyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 24640863) has the molecular formula C18H18BrN3O6S and a molecular weight of 484.33 g/mol. Its IUPAC name is N-[3-[2-(4-bromobenzoyl)hydrazinyl]-3-oxopropyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[3-[2-(4-bromobenzoyl)hydrazinyl]-3-oxopropyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 24640863 |
| Molecular Formula | C18H18BrN3O6S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | N-[3-[2-(4-bromobenzoyl)hydrazinyl]-3-oxopropyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)OCCO2)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O6S/c19-13-3-1-12(2-4-13)18(24)22-21-17(23)7-8-20-29(25,26)14-5-6-15-16(11-14)28-10-9-27-15/h1-6,11,20H,7-10H2,(H,21,23)(H,22,24) |
| InChIKey | NDKCINIRFCSGIJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|