C18H21N5O6S — CID 18288057
N-[4-oxo-4-[2-(pyrazine-2-carbonyl)hydrazinyl]butyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 18288057) has the molecular formula C18H21N5O6S and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[4-oxo-4-[2-(pyrazine-2-carbonyl)hydrazinyl]butyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[4-oxo-4-[2-(pyrazine-2-carbonyl)hydrazinyl]butyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 18288057 |
| Molecular Formula | C18H21N5O6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[4-oxo-4-[2-(pyrazine-2-carbonyl)hydrazinyl]butyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCCO2)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C18H21N5O6S/c24-17(22-23-18(25)14-12-19-7-8-20-14)3-1-6-21-30(26,27)13-4-5-15-16(11-13)29-10-2-9-28-15/h4-5,7-8,11-12,21H,1-3,6,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | BCUFTVHYVJSLGY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|