C16H15N3O3S3 — CID 2464991
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 2464991) has the molecular formula C16H15N3O3S3 and a molecular weight of 393.52 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2464991 |
| Molecular Formula | C16H15N3O3S3 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cs1)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C16H15N3O3S3/c20-13(17-6-7-19-14(21)10-25-16(19)22)9-24-15-18-12(8-23-15)11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,17,20) |
| InChIKey | KHQGMDFPPMVLJD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|