C12H9N3OS2 — CID 899465
3-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 899465) has the molecular formula C12H9N3OS2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 899465 |
| Molecular Formula | C12H9N3OS2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-(4-phenyl-1,3-thiazol-2-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1CNC(=S)N1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C12H9N3OS2/c16-10-6-13-11(17)15(10)12-14-9(7-18-12)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,17) |
| InChIKey | AOZFVNQLWLAVQQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|