C25H33NO4 — CID 24649931
2-(3-methylphenoxy)ethyl 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 24649931) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | 2-(3-methylphenoxy)ethyl 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 24649931 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | Cc1cccc(OCCOC(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C25H33NO4/c1-17-4-2-5-21(10-17)29-8-9-30-23(27)22-6-3-7-26(22)24(28)25-14-18-11-19(15-25)13-20(12-18)16-25/h2,4-5,10,18-20,22H,3,6-9,11-16H2,1H3 |
| InChIKey | WXKRPLNWFCEMDB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|