C17H20BrNO4 — CID 24652186
methyl 3-bromo-4-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethoxy]benzoate (PubChem CID 24652186) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is methyl 3-bromo-4-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-bromo-4-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 24652186 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | methyl 3-bromo-4-[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethoxy]benzoate |
| SMILES | C#CC(CC)(CC)NC(=O)COc1ccc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C17H20BrNO4/c1-5-17(6-2,7-3)19-15(20)11-23-14-9-8-12(10-13(14)18)16(21)22-4/h1,8-10H,6-7,11H2,2-4H3,(H,19,20) |
| InChIKey | AKYYYRNUNJFBQY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|