C16H14BrNO6S — CID 36943388
methyl 3-[[2-(2-bromo-4-methoxycarbonylphenoxy)acetyl]amino]thiophene-2-carboxylate (PubChem CID 36943388) has the molecular formula C16H14BrNO6S and a molecular weight of 428.26 g/mol. Its IUPAC name is methyl 3-[[2-(2-bromo-4-methoxycarbonylphenoxy)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(2-bromo-4-methoxycarbonylphenoxy)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 36943388 |
| Molecular Formula | C16H14BrNO6S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | methyl 3-[[2-(2-bromo-4-methoxycarbonylphenoxy)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2ccsc2C(=O)OC)c(Br)c1 |
| InChI | InChI=1S/C16H14BrNO6S/c1-22-15(20)9-3-4-12(10(17)7-9)24-8-13(19)18-11-5-6-25-14(11)16(21)23-2/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | VZKHNZREYNNVMS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |