C23H21N3O3S — CID 24653539
N-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 24653539) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24653539 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[2-[[3-(cyclopropanecarbonylamino)phenyl]methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1cccc(NC(=O)C2CC2)c1)c1cccs1 |
| InChI | InChI=1S/C23H21N3O3S/c27-21(16-10-11-16)25-17-6-3-5-15(13-17)14-24-22(28)18-7-1-2-8-19(18)26-23(29)20-9-4-12-30-20/h1-9,12-13,16H,10-11,14H2,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | PEQSNUSGOUONCM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |