C27H28N2O3S — CID 24655874
(2S)-2-[(4-methylphenyl)sulfonylamino]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)propanamide (PubChem CID 24655874) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)propanamide.
| Compound Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)propanamide |
|---|---|
| PubChem CID | 24655874 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2S)-2-[(4-methylphenyl)sulfonylamino]-N-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenylmethyl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NCC2CC3c4ccccc4C2c2ccccc23)cc1 |
| InChI | InChI=1S/C27H28N2O3S/c1-17-11-13-20(14-12-17)33(31,32)29-18(2)27(30)28-16-19-15-25-21-7-3-5-9-23(21)26(19)24-10-6-4-8-22(24)25/h3-14,18-19,25-26,29H,15-16H2,1-2H3,(H,28,30)/t18-,19?,25?,26?/m0/s1 |
| InChIKey | GOURFEYQWGAGGB-ZQLXEFMQSA-N |
| XLogP | 4.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |