C25H23ClN2O5S — CID 24667823
N-[2-chloro-4-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide (PubChem CID 24667823) has the molecular formula C25H23ClN2O5S and a molecular weight of 498.99 g/mol. Its IUPAC name is N-[2-chloro-4-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[2-chloro-4-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 24667823 |
| Molecular Formula | C25H23ClN2O5S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[2-chloro-4-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)Nc1ccc(NC(=O)c2cccc(S(C)(=O)=O)c2)c(Cl)c1 |
| InChI | InChI=1S/C25H23ClN2O5S/c1-3-33-23-10-5-4-7-17(23)11-14-24(29)27-19-12-13-22(21(26)16-19)28-25(30)18-8-6-9-20(15-18)34(2,31)32/h4-16H,3H2,1-2H3,(H,27,29)(H,28,30)/b14-11+ |
| InChIKey | IIGWZFGQKAJOHF-SDNWHVSQSA-N |
| XLogP | 5.05 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|