C25H23ClN2O4S — CID 24667870
N-[2-chloro-4-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide (PubChem CID 24667870) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is N-[2-chloro-4-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[2-chloro-4-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 24667870 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[2-chloro-4-[[(E)-3-(4-ethylphenyl)prop-2-enoyl]amino]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CCc1ccc(/C=C/C(=O)Nc2ccc(NC(=O)c3cccc(S(C)(=O)=O)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H23ClN2O4S/c1-3-17-7-9-18(10-8-17)11-14-24(29)27-20-12-13-23(22(26)16-20)28-25(30)19-5-4-6-21(15-19)33(2,31)32/h4-16H,3H2,1-2H3,(H,27,29)(H,28,30)/b14-11+ |
| InChIKey | HHNXQCBRKYVAJG-SDNWHVSQSA-N |
| XLogP | 5.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|