C17H18N6O3S — CID 24669149
3-phenyl-N-[4-(sulfamoylmethyl)phenyl]-2-(tetrazol-1-yl)propanamide (PubChem CID 24669149) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is 3-phenyl-N-[4-(sulfamoylmethyl)phenyl]-2-(tetrazol-1-yl)propanamide.
| Compound Name | 3-phenyl-N-[4-(sulfamoylmethyl)phenyl]-2-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 24669149 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-phenyl-N-[4-(sulfamoylmethyl)phenyl]-2-(tetrazol-1-yl)propanamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)C(Cc2ccccc2)n2cnnn2)cc1 |
| InChI | InChI=1S/C17H18N6O3S/c18-27(25,26)11-14-6-8-15(9-7-14)20-17(24)16(23-12-19-21-22-23)10-13-4-2-1-3-5-13/h1-9,12,16H,10-11H2,(H,20,24)(H2,18,25,26) |
| InChIKey | VRNXMVONOSIDAU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |