C16H14FN5O2 — CID 86798495
N-(2-fluoro-4-hydroxyphenyl)-3-phenyl-2-(tetrazol-1-yl)propanamide (PubChem CID 86798495) has the molecular formula C16H14FN5O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxyphenyl)-3-phenyl-2-(tetrazol-1-yl)propanamide.
| Compound Name | N-(2-fluoro-4-hydroxyphenyl)-3-phenyl-2-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 86798495 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(2-fluoro-4-hydroxyphenyl)-3-phenyl-2-(tetrazol-1-yl)propanamide |
| SMILES | O=C(Nc1ccc(O)cc1F)C(Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C16H14FN5O2/c17-13-9-12(23)6-7-14(13)19-16(24)15(22-10-18-20-21-22)8-11-4-2-1-3-5-11/h1-7,9-10,15,23H,8H2,(H,19,24) |
| InChIKey | SZSAYTVKOCBIDD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|