C20H27ClN4O2S — CID 24670123
2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 24670123) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is 2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 24670123 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CCc1nc(SCC(=O)NCCCOC(C)C)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN4O2S/c1-4-16-18(14-6-8-15(21)9-7-14)19(22)25-20(24-16)28-12-17(26)23-10-5-11-27-13(2)3/h6-9,13H,4-5,10-12H2,1-3H3,(H,23,26)(H2,22,24,25) |
| InChIKey | NBUGLEFFWDRAHP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|