C20H20ClN3OS — CID 25331771
(1S)-2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-1-phenylethanol (PubChem CID 25331771) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is (1S)-2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-1-phenylethanol.
| Compound Name | (1S)-2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-1-phenylethanol |
|---|---|
| PubChem CID | 25331771 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (1S)-2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanyl-1-phenylethanol |
| SMILES | CCc1nc(SC[C@@H](O)c2ccccc2)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3OS/c1-2-16-18(14-8-10-15(21)11-9-14)19(22)24-20(23-16)26-12-17(25)13-6-4-3-5-7-13/h3-11,17,25H,2,12H2,1H3,(H2,22,23,24)/t17-/m1/s1 |
| InChIKey | KSEXYBDZBHMTCU-QGZVFWFLSA-N |
| XLogP | 4.77 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |