C21H19Cl2N5O2S — CID 24670056
N'-[2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanylacetyl]-4-chlorobenzohydrazide (PubChem CID 24670056) has the molecular formula C21H19Cl2N5O2S and a molecular weight of 476.39 g/mol. Its IUPAC name is N'-[2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanylacetyl]-4-chlorobenzohydrazide.
| Compound Name | N'-[2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanylacetyl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 24670056 |
| Molecular Formula | C21H19Cl2N5O2S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N'-[2-[4-amino-5-(4-chlorophenyl)-6-ethylpyrimidin-2-yl]sulfanylacetyl]-4-chlorobenzohydrazide |
| SMILES | CCc1nc(SCC(=O)NNC(=O)c2ccc(Cl)cc2)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2N5O2S/c1-2-16-18(12-3-7-14(22)8-4-12)19(24)26-21(25-16)31-11-17(29)27-28-20(30)13-5-9-15(23)10-6-13/h3-10H,2,11H2,1H3,(H,27,29)(H,28,30)(H2,24,25,26) |
| InChIKey | MVBSWHAOYAORAV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|