C23H18FN3O3S — CID 24672819
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 24672819) has the molecular formula C23H18FN3O3S and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24672819 |
| Molecular Formula | C23H18FN3O3S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NCc3ccc(-c4ccc(F)cc4)o3)ccc2c1=O |
| InChI | InChI=1S/C23H18FN3O3S/c1-2-11-27-22(29)18-9-5-15(12-19(18)26-23(27)31)21(28)25-13-17-8-10-20(30-17)14-3-6-16(24)7-4-14/h2-10,12H,1,11,13H2,(H,25,28)(H,26,31) |
| InChIKey | NJHWCSIYLAECTM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|