C17H11ClF2N2OS — CID 24673455
N-(6-chloroquinolin-8-yl)-2-(2,4-difluorophenyl)sulfanylacetamide (PubChem CID 24673455) has the molecular formula C17H11ClF2N2OS and a molecular weight of 364.80 g/mol. Its IUPAC name is N-(6-chloroquinolin-8-yl)-2-(2,4-difluorophenyl)sulfanylacetamide.
| Compound Name | N-(6-chloroquinolin-8-yl)-2-(2,4-difluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 24673455 |
| Molecular Formula | C17H11ClF2N2OS |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-(6-chloroquinolin-8-yl)-2-(2,4-difluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(F)cc1F)Nc1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C17H11ClF2N2OS/c18-11-6-10-2-1-5-21-17(10)14(7-11)22-16(23)9-24-15-4-3-12(19)8-13(15)20/h1-8H,9H2,(H,22,23) |
| InChIKey | LMSMAIMQOKOJMN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |