C24H17ClFN3O3 — CID 43052391
N-(6-chloroquinolin-8-yl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide (PubChem CID 43052391) has the molecular formula C24H17ClFN3O3 and a molecular weight of 449.87 g/mol. Its IUPAC name is N-(6-chloroquinolin-8-yl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide.
| Compound Name | N-(6-chloroquinolin-8-yl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 43052391 |
| Molecular Formula | C24H17ClFN3O3 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-(6-chloroquinolin-8-yl)-2-[2-(2-fluoroanilino)-2-oxoethoxy]benzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1cc(Cl)cc2cccnc12)Nc1ccccc1F |
| InChI | InChI=1S/C24H17ClFN3O3/c25-16-12-15-6-5-11-27-23(15)20(13-16)29-24(31)17-7-1-4-10-21(17)32-14-22(30)28-19-9-3-2-8-18(19)26/h1-13H,14H2,(H,28,30)(H,29,31) |
| InChIKey | BRVNLZAEMNCOCU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |