C19H21N3O2S — CID 24675134
5-cyano-2-methyl-N-phenyl-6-(2-propan-2-yloxyethylsulfanyl)pyridine-3-carboxamide (PubChem CID 24675134) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-cyano-2-methyl-N-phenyl-6-(2-propan-2-yloxyethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | 5-cyano-2-methyl-N-phenyl-6-(2-propan-2-yloxyethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24675134 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-cyano-2-methyl-N-phenyl-6-(2-propan-2-yloxyethylsulfanyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(SCCOC(C)C)c(C#N)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-13(2)24-9-10-25-19-15(12-20)11-17(14(3)21-19)18(23)22-16-7-5-4-6-8-16/h4-8,11,13H,9-10H2,1-3H3,(H,22,23) |
| InChIKey | PYQAVSFJCQFESF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|