C25H24N4O2S — CID 24678812
N-[1-[4-(1H-benzimidazol-2-yl)anilino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 24678812) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[1-[4-(1H-benzimidazol-2-yl)anilino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[4-(1H-benzimidazol-2-yl)anilino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 24678812 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[1-[4-(1H-benzimidazol-2-yl)anilino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1)C(=O)Nc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-32-16-15-22(29-24(30)18-7-3-2-4-8-18)25(31)26-19-13-11-17(12-14-19)23-27-20-9-5-6-10-21(20)28-23/h2-14,22H,15-16H2,1H3,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | PPRICXTTXBTRJG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |