C19H19N5O5S3 — CID 24680355
N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 24680355) has the molecular formula C19H19N5O5S3 and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 24680355 |
| Molecular Formula | C19H19N5O5S3 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccs2)CC1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C19H19N5O5S3/c25-17(12-22-6-8-23(9-7-22)32(28,29)18-5-2-10-30-18)21-19-20-16(13-31-19)14-3-1-4-15(11-14)24(26)27/h1-5,10-11,13H,6-9,12H2,(H,20,21,25) |
| InChIKey | NTRGDEUELPNOJF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|