C19H17ClN4O5S3 — CID 41100082
1-(5-chlorothiophen-2-yl)sulfonyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 41100082) has the molecular formula C19H17ClN4O5S3 and a molecular weight of 513.02 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41100082 |
| Molecular Formula | C19H17ClN4O5S3 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C19H17ClN4O5S3/c20-16-4-5-17(31-16)32(28,29)23-8-6-12(7-9-23)18(25)22-19-21-15(11-30-19)13-2-1-3-14(10-13)24(26)27/h1-5,10-12H,6-9H2,(H,21,22,25) |
| InChIKey | PVHXHVARCJWSKT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|