C17H11ClN4O4S2 — CID 60529598
3-(5-chlorothiophen-2-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 60529598) has the molecular formula C17H11ClN4O4S2 and a molecular weight of 434.89 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 60529598 |
| Molecular Formula | C17H11ClN4O4S2 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)C1CC(c2ccc(Cl)s2)=NO1 |
| InChI | InChI=1S/C17H11ClN4O4S2/c18-15-5-4-14(28-15)11-7-13(26-21-11)16(23)20-17-19-12(8-27-17)9-2-1-3-10(6-9)22(24)25/h1-6,8,13H,7H2,(H,19,20,23) |
| InChIKey | DPHJIOCYZJEPHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|