C17H23F3N6 — CID 24680587
3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]butane-1,2-diamine (PubChem CID 24680587) has the molecular formula C17H23F3N6 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]butane-1,2-diamine.
| Compound Name | 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]butane-1,2-diamine |
|---|---|
| PubChem CID | 24680587 |
| Molecular Formula | C17H23F3N6 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 3-methyl-2-N,2-N-bis(prop-2-enyl)-1-N-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]butane-1,2-diamine |
| SMILES | C=CCN(CC=C)C(CNc1ccc2nnc(C(F)(F)F)n2n1)C(C)C |
| InChI | InChI=1S/C17H23F3N6/c1-5-9-25(10-6-2)13(12(3)4)11-21-14-7-8-15-22-23-16(17(18,19)20)26(15)24-14/h5-8,12-13H,1-2,9-11H2,3-4H3,(H,21,24) |
| InChIKey | GUNMFLIYACCRDW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|