C26H21N5O4S — CID 24681800
2-[4-[4-(4-oxoquinazolin-3-yl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24681800) has the molecular formula C26H21N5O4S and a molecular weight of 499.55 g/mol. Its IUPAC name is 2-[4-[4-(4-oxoquinazolin-3-yl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[4-(4-oxoquinazolin-3-yl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24681800 |
| Molecular Formula | C26H21N5O4S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 2-[4-[4-(4-oxoquinazolin-3-yl)benzoyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(C(=O)c2ccc(-n3cnc4ccccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C26H21N5O4S/c27-17-20-5-1-4-8-24(20)36(34,35)30-15-13-29(14-16-30)25(32)19-9-11-21(12-10-19)31-18-28-23-7-3-2-6-22(23)26(31)33/h1-12,18H,13-16H2 |
| InChIKey | PKJUOJZCNIRSEJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 116.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |