C16H18ClN5O4S — CID 24682260
N'-[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide (PubChem CID 24682260) has the molecular formula C16H18ClN5O4S and a molecular weight of 411.87 g/mol. Its IUPAC name is N'-[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 24682260 |
| Molecular Formula | C16H18ClN5O4S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N'-[2-[(2-chloro-5-nitrophenyl)methyl-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
| SMILES | Cc1csc(CC(=O)NNC(=O)CN(C)Cc2cc([N+](=O)[O-])ccc2Cl)n1 |
| InChI | InChI=1S/C16H18ClN5O4S/c1-10-9-27-16(18-10)6-14(23)19-20-15(24)8-21(2)7-11-5-12(22(25)26)3-4-13(11)17/h3-5,9H,6-8H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | WLZVDUUAVVIXHC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|