C17H22N4O2S — CID 78903075
2-(4-methyl-1,3-thiazol-2-yl)-N'-[2-(N,2,4-trimethylanilino)acetyl]acetohydrazide (PubChem CID 78903075) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N'-[2-(N,2,4-trimethylanilino)acetyl]acetohydrazide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[2-(N,2,4-trimethylanilino)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 78903075 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[2-(N,2,4-trimethylanilino)acetyl]acetohydrazide |
| SMILES | Cc1ccc(N(C)CC(=O)NNC(=O)Cc2nc(C)cs2)c(C)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-11-5-6-14(12(2)7-11)21(4)9-16(23)20-19-15(22)8-17-18-13(3)10-24-17/h5-7,10H,8-9H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | FENVJNZFSYLWPM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|