C15H19ClN4O2S2 — CID 55432428
N'-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide (PubChem CID 55432428) has the molecular formula C15H19ClN4O2S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is N'-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 55432428 |
| Molecular Formula | C15H19ClN4O2S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N'-[2-[(5-chlorothiophen-2-yl)methyl-ethylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
| SMILES | CCN(CC(=O)NNC(=O)Cc1nc(C)cs1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C15H19ClN4O2S2/c1-3-20(7-11-4-5-12(16)24-11)8-14(22)19-18-13(21)6-15-17-10(2)9-23-15/h4-5,9H,3,6-8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | MMUUPNPXXIRWPI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|