C18H20N4O4S — CID 24507331
N'-[2-[bis(furan-2-ylmethyl)amino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide (PubChem CID 24507331) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N'-[2-[bis(furan-2-ylmethyl)amino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-[bis(furan-2-ylmethyl)amino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 24507331 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N'-[2-[bis(furan-2-ylmethyl)amino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
| SMILES | Cc1csc(CC(=O)NNC(=O)CN(Cc2ccco2)Cc2ccco2)n1 |
| InChI | InChI=1S/C18H20N4O4S/c1-13-12-27-18(19-13)8-16(23)20-21-17(24)11-22(9-14-4-2-6-25-14)10-15-5-3-7-26-15/h2-7,12H,8-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | SJEIQZUCIPOCGU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|