C22H23FN4O2S — CID 78840619
N'-[2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide (PubChem CID 78840619) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-[2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide.
| Compound Name | N'-[2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 78840619 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N'-[2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetyl]-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
| SMILES | Cc1csc(CC(=O)NNC(=O)CN(C)C(c2ccccc2)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H23FN4O2S/c1-15-14-30-21(24-15)12-19(28)25-26-20(29)13-27(2)22(16-6-4-3-5-7-16)17-8-10-18(23)11-9-17/h3-11,14,22H,12-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | UJUPTUBIDVOKRK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|