C24H30N2O4S2 — CID 24683506
1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-tert-butylphenyl)sulfanylethanone (PubChem CID 24683506) has the molecular formula C24H30N2O4S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-tert-butylphenyl)sulfanylethanone.
| Compound Name | 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-tert-butylphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 24683506 |
| Molecular Formula | C24H30N2O4S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-2-(4-tert-butylphenyl)sulfanylethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)CSc3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O4S2/c1-18(27)19-5-11-22(12-6-19)32(29,30)26-15-13-25(14-16-26)23(28)17-31-21-9-7-20(8-10-21)24(2,3)4/h5-12H,13-17H2,1-4H3 |
| InChIKey | ORLNIQVVWIJYDT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |