C24H25ClN2O5 — CID 24684308
(E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]prop-2-enamide (PubChem CID 24684308) has the molecular formula C24H25ClN2O5 and a molecular weight of 456.93 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24684308 |
| Molecular Formula | C24H25ClN2O5 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(CN3C(=O)CCC3=O)cc2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C24H25ClN2O5/c1-15(2)32-24-19(25)12-17(13-20(24)31-3)6-9-21(28)26-18-7-4-16(5-8-18)14-27-22(29)10-11-23(27)30/h4-9,12-13,15H,10-11,14H2,1-3H3,(H,26,28)/b9-6+ |
| InChIKey | NVGTXUMPGJIUDP-RMKNXTFCSA-N |
| XLogP | 4.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|