C23H24ClN3O3 — CID 86977849
(E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 86977849) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86977849 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-N-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(Cn3ccnc3)cc2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C23H24ClN3O3/c1-16(2)30-23-20(24)12-18(13-21(23)29-3)6-9-22(28)26-19-7-4-17(5-8-19)14-27-11-10-25-15-27/h4-13,15-16H,14H2,1-3H3,(H,26,28)/b9-6+ |
| InChIKey | HRVONOXPVHFXAG-RMKNXTFCSA-N |
| XLogP | 5.03 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|