C12H12N2O4 — CID 24696899
5-acetamido-2-(prop-2-enoylamino)benzoic acid (PubChem CID 24696899) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-acetamido-2-(prop-2-enoylamino)benzoic acid.
| Compound Name | 5-acetamido-2-(prop-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 24696899 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-acetamido-2-(prop-2-enoylamino)benzoic acid |
| SMILES | C=CC(=O)Nc1ccc(NC(C)=O)cc1C(=O)O |
| InChI | InChI=1S/C12H12N2O4/c1-3-11(16)14-10-5-4-8(13-7(2)15)6-9(10)12(17)18/h3-6H,1H2,2H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | OOQQSWIFYKYBJE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|