C13H16N2O4S2 — CID 20813442
5-acetamido-2-[3-(methyldisulfanyl)propanoylamino]benzoic acid (PubChem CID 20813442) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-acetamido-2-[3-(methyldisulfanyl)propanoylamino]benzoic acid.
| Compound Name | 5-acetamido-2-[3-(methyldisulfanyl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 20813442 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-acetamido-2-[3-(methyldisulfanyl)propanoylamino]benzoic acid |
| SMILES | CSSCCC(=O)Nc1ccc(NC(C)=O)cc1C(=O)O |
| InChI | InChI=1S/C13H16N2O4S2/c1-8(16)14-9-3-4-11(10(7-9)13(18)19)15-12(17)5-6-21-20-2/h3-4,7H,5-6H2,1-2H3,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | IIYIAZWQQBOIAO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|