C10H12N2O4 — CID 24699948
4-[(6-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid (PubChem CID 24699948) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-[(6-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(6-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 24699948 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4-[(6-oxo-1H-pyridine-3-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C10H12N2O4/c13-8-4-3-7(6-12-8)10(16)11-5-1-2-9(14)15/h3-4,6H,1-2,5H2,(H,11,16)(H,12,13)(H,14,15) |
| InChIKey | CJZYFDRLASWHQX-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|