C6H14N2OS — CID 24704933
2-(2-aminoethylsulfanyl)-N,N-dimethylacetamide (PubChem CID 24704933) has the molecular formula C6H14N2OS and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N,N-dimethylacetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 24704933 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSCCN |
| InChI | InChI=1S/C6H14N2OS/c1-8(2)6(9)5-10-4-3-7/h3-5,7H2,1-2H3 |
| InChIKey | RKLAQGBFZWDSGR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|