C19H18N2O4 — CID 24716700
4-(1,3-benzodioxole-5-carbonyl)-3-methyl-1-phenylpiperazin-2-one (PubChem CID 24716700) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-(1,3-benzodioxole-5-carbonyl)-3-methyl-1-phenylpiperazin-2-one.
| Compound Name | 4-(1,3-benzodioxole-5-carbonyl)-3-methyl-1-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 24716700 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-(1,3-benzodioxole-5-carbonyl)-3-methyl-1-phenylpiperazin-2-one |
| SMILES | CC1C(=O)N(c2ccccc2)CCN1C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N2O4/c1-13-18(22)21(15-5-3-2-4-6-15)10-9-20(13)19(23)14-7-8-16-17(11-14)25-12-24-16/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | VENJRIPUPDPJOO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |