C16H19N3O3S3 — CID 2472664
N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 2472664) has the molecular formula C16H19N3O3S3 and a molecular weight of 397.55 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2472664 |
| Molecular Formula | C16H19N3O3S3 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-methyl-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | CN(C(=O)CSc1ncnc2sc3c(c12)CCC3)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19N3O3S3/c1-19(10-5-6-25(21,22)8-10)13(20)7-23-15-14-11-3-2-4-12(11)24-16(14)18-9-17-15/h9-10H,2-8H2,1H3/t10-/m1/s1 |
| InChIKey | DBMBTTTXWWKCJE-SNVBAGLBSA-N |
| XLogP | 1.92 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |