C19H25N3O3S3 — CID 4817737
N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide (PubChem CID 4817737) has the molecular formula C19H25N3O3S3 and a molecular weight of 439.63 g/mol. Its IUPAC name is N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide.
| Compound Name | N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 4817737 |
| Molecular Formula | C19H25N3O3S3 |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-butan-2-yl-N-(1,1-dioxothiolan-3-yl)-2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetamide |
| SMILES | CCC(C)N(C(=O)CSc1ncnc2sc3c(c12)CCC3)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H25N3O3S3/c1-3-12(2)22(13-7-8-28(24,25)10-13)16(23)9-26-18-17-14-5-4-6-15(14)27-19(17)21-11-20-18/h11-13H,3-10H2,1-2H3 |
| InChIKey | MFHOLNSMDCXTIU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |