C22H28N4O5 — CID 24730591
ethyl 2-[3-(benzylcarbamoyl)-4-(furan-2-ylmethylcarbamoyl)piperazin-1-yl]acetate (PubChem CID 24730591) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 2-[3-(benzylcarbamoyl)-4-(furan-2-ylmethylcarbamoyl)piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[3-(benzylcarbamoyl)-4-(furan-2-ylmethylcarbamoyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 24730591 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | ethyl 2-[3-(benzylcarbamoyl)-4-(furan-2-ylmethylcarbamoyl)piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(C(=O)NCc2ccco2)C(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H28N4O5/c1-2-30-20(27)16-25-10-11-26(22(29)24-14-18-9-6-12-31-18)19(15-25)21(28)23-13-17-7-4-3-5-8-17/h3-9,12,19H,2,10-11,13-16H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | LJLLPCHLFBINJN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |