C23H21N5O3S — CID 24731076
N-(2-cyanophenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide (PubChem CID 24731076) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide.
| Compound Name | N-(2-cyanophenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 24731076 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(2-cyanophenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)N1CCC(S(=O)(=O)c2ccc(-c3cncnc3)cc2)CC1 |
| InChI | InChI=1S/C23H21N5O3S/c24-13-18-3-1-2-4-22(18)27-23(29)28-11-9-21(10-12-28)32(30,31)20-7-5-17(6-8-20)19-14-25-16-26-15-19/h1-8,14-16,21H,9-12H2,(H,27,29) |
| InChIKey | YSXBGHVKOXYISF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |