C23H24N4O3S2 — CID 24731073
N-(2-methylsulfanylphenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide (PubChem CID 24731073) has the molecular formula C23H24N4O3S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide.
| Compound Name | N-(2-methylsulfanylphenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 24731073 |
| Molecular Formula | C23H24N4O3S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-4-(4-pyrimidin-5-ylphenyl)sulfonylpiperidine-1-carboxamide |
| SMILES | CSc1ccccc1NC(=O)N1CCC(S(=O)(=O)c2ccc(-c3cncnc3)cc2)CC1 |
| InChI | InChI=1S/C23H24N4O3S2/c1-31-22-5-3-2-4-21(22)26-23(28)27-12-10-20(11-13-27)32(29,30)19-8-6-17(7-9-19)18-14-24-16-25-15-18/h2-9,14-16,20H,10-13H2,1H3,(H,26,28) |
| InChIKey | GVEQQZCGNRTDAH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |