C20H20F2N2O5S — CID 24731896
methyl 2-[1-[(2,4-difluorophenyl)carbamoyl]piperidin-4-yl]sulfonylbenzoate (PubChem CID 24731896) has the molecular formula C20H20F2N2O5S and a molecular weight of 438.45 g/mol. Its IUPAC name is methyl 2-[1-[(2,4-difluorophenyl)carbamoyl]piperidin-4-yl]sulfonylbenzoate.
| Compound Name | methyl 2-[1-[(2,4-difluorophenyl)carbamoyl]piperidin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 24731896 |
| Molecular Formula | C20H20F2N2O5S |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | methyl 2-[1-[(2,4-difluorophenyl)carbamoyl]piperidin-4-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)C1CCN(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C20H20F2N2O5S/c1-29-19(25)15-4-2-3-5-18(15)30(27,28)14-8-10-24(11-9-14)20(26)23-17-7-6-13(21)12-16(17)22/h2-7,12,14H,8-11H2,1H3,(H,23,26) |
| InChIKey | NDGWZWSBOOIVLV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |