C16H14N3O2- — CID 2473221
(E)-3-[1-(2-cyanoethyl)-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoate (PubChem CID 2473221) has the molecular formula C16H14N3O2- and a molecular weight of 280.31 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | (E)-3-[1-(2-cyanoethyl)-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2473221 |
| Molecular Formula | C16H14N3O2- |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)-3-(4-methylphenyl)pyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(-c2nn(CCC#N)cc2/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N3O2/c1-12-3-5-13(6-4-12)16-14(7-8-15(20)21)11-19(18-16)10-2-9-17/h3-8,11H,2,10H2,1H3,(H,20,21)/p-1/b8-7+ |
| InChIKey | NAZMHZNZTLOWII-BQYQJAHWSA-M |
| XLogP | 1.54 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|