C15H19F2N3O2 — CID 24733104
1-(3,4-difluorobenzoyl)-4-ethyl-N-methylpiperazine-2-carboxamide (PubChem CID 24733104) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-(3,4-difluorobenzoyl)-4-ethyl-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-(3,4-difluorobenzoyl)-4-ethyl-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 24733104 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-(3,4-difluorobenzoyl)-4-ethyl-N-methylpiperazine-2-carboxamide |
| SMILES | CCN1CCN(C(=O)c2ccc(F)c(F)c2)C(C(=O)NC)C1 |
| InChI | InChI=1S/C15H19F2N3O2/c1-3-19-6-7-20(13(9-19)14(21)18-2)15(22)10-4-5-11(16)12(17)8-10/h4-5,8,13H,3,6-7,9H2,1-2H3,(H,18,21) |
| InChIKey | GSCWBDZPXPZTEF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |